C18H28ClFN2O — CID 69261997
2-[(S)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chloro-2-fluorophenyl)methoxy]ethanamine (PubChem CID 69261997) has the molecular formula C18H28ClFN2O and a molecular weight of 342.89 g/mol. Its IUPAC name is 2-[(S)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chloro-2-fluorophenyl)methoxy]ethanamine.
| Compound Name | 2-[(S)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chloro-2-fluorophenyl)methoxy]ethanamine |
|---|---|
| PubChem CID | 69261997 |
| Molecular Formula | C18H28ClFN2O |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 2-[(S)-[(3R)-1-tert-butylpiperidin-3-yl]-(3-chloro-2-fluorophenyl)methoxy]ethanamine |
| SMILES | CC(C)(C)N1CCC[C@@H]([C@H](OCCN)c2cccc(Cl)c2F)C1 |
| InChI | InChI=1S/C18H28ClFN2O/c1-18(2,3)22-10-5-6-13(12-22)17(23-11-9-21)14-7-4-8-15(19)16(14)20/h4,7-8,13,17H,5-6,9-12,21H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | LLDTZEHALWDPGW-DYVFJYSZSA-N |
| XLogP | 4.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |