C18H23ClN2O3 — CID 141128599
[2-(3-chlorophenyl)-2-cyclopentylacetyl] piperazine-1-carboxylate (PubChem CID 141128599) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is [2-(3-chlorophenyl)-2-cyclopentylacetyl] piperazine-1-carboxylate.
| Compound Name | [2-(3-chlorophenyl)-2-cyclopentylacetyl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141128599 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | [2-(3-chlorophenyl)-2-cyclopentylacetyl] piperazine-1-carboxylate |
| SMILES | O=C(OC(=O)N1CCNCC1)C(c1cccc(Cl)c1)C1CCCC1 |
| InChI | InChI=1S/C18H23ClN2O3/c19-15-7-3-6-14(12-15)16(13-4-1-2-5-13)17(22)24-18(23)21-10-8-20-9-11-21/h3,6-7,12-13,16,20H,1-2,4-5,8-11H2 |
| InChIKey | WFEKLUVAORIAGH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|