C24H35ClN2O3 — CID 90756258
[1-[2-(3-chlorophenyl)-2-cyclohexylacetyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 90756258) has the molecular formula C24H35ClN2O3 and a molecular weight of 435.01 g/mol. Its IUPAC name is [1-[2-(3-chlorophenyl)-2-cyclohexylacetyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-[2-(3-chlorophenyl)-2-cyclohexylacetyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90756258 |
| Molecular Formula | C24H35ClN2O3 |
| Molecular Weight | 435.01 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [1-[2-(3-chlorophenyl)-2-cyclohexylacetyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(C(=O)C(c2cccc(Cl)c2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H35ClN2O3/c1-24(2,3)26-23(29)30-20-12-14-27(15-13-20)22(28)21(17-8-5-4-6-9-17)18-10-7-11-19(25)16-18/h7,10-11,16-17,20-21H,4-6,8-9,12-15H2,1-3H3,(H,26,29) |
| InChIKey | OLEVLZJPXHEADY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.01 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |