C28H41ClN2O4 — CID 90992380
[1-[2-(3-chlorophenyl)-2-(2-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)acetyl]piperidin-4-yl] N-tert-butylcarbamate (PubChem CID 90992380) has the molecular formula C28H41ClN2O4 and a molecular weight of 505.10 g/mol. Its IUPAC name is [1-[2-(3-chlorophenyl)-2-(2-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)acetyl]piperidin-4-yl] N-tert-butylcarbamate.
| Compound Name | [1-[2-(3-chlorophenyl)-2-(2-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)acetyl]piperidin-4-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 90992380 |
| Molecular Formula | C28H41ClN2O4 |
| Molecular Weight | 505.10 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | [1-[2-(3-chlorophenyl)-2-(2-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-yl)acetyl]piperidin-4-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC1CCN(C(=O)C(c2cccc(Cl)c2)C2(O)CCC3CCCCC3C2)CC1 |
| InChI | InChI=1S/C28H41ClN2O4/c1-27(2,3)30-26(33)35-23-12-15-31(16-13-23)25(32)24(20-9-6-10-22(29)17-20)28(34)14-11-19-7-4-5-8-21(19)18-28/h6,9-10,17,19,21,23-24,34H,4-5,7-8,11-16,18H2,1-3H3,(H,30,33) |
| InChIKey | VYYZVSIWVAHMCF-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.10 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |