C24H36ClNO — CID 59701308
2-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol (PubChem CID 59701308) has the molecular formula C24H36ClNO and a molecular weight of 390.01 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol.
| Compound Name | 2-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 59701308 |
| Molecular Formula | C24H36ClNO |
| Molecular Weight | 390.01 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 2-[1-(3-chlorophenyl)-2-(4-methylpiperidin-1-yl)ethyl]-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
| SMILES | CC1CCN(CC(c2cccc(Cl)c2)C2(O)CCC3CCCCC3C2)CC1 |
| InChI | InChI=1S/C24H36ClNO/c1-18-10-13-26(14-11-18)17-23(20-7-4-8-22(25)15-20)24(27)12-9-19-5-2-3-6-21(19)16-24/h4,7-8,15,18-19,21,23,27H,2-3,5-6,9-14,16-17H2,1H3 |
| InChIKey | GWKCCMFQRKBISO-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.01 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |