C24H37ClN2O — CID 143036814
5-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-1,2,3,4,4a,6,7,8,9,9a-decahydrobenzo[7]annulen-5-ol (PubChem CID 143036814) has the molecular formula C24H37ClN2O and a molecular weight of 405.03 g/mol. Its IUPAC name is 5-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-1,2,3,4,4a,6,7,8,9,9a-decahydrobenzo[7]annulen-5-ol.
| Compound Name | 5-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-1,2,3,4,4a,6,7,8,9,9a-decahydrobenzo[7]annulen-5-ol |
|---|---|
| PubChem CID | 143036814 |
| Molecular Formula | C24H37ClN2O |
| Molecular Weight | 405.03 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | 5-[1-(3-chlorophenyl)-2-(4-methylpiperazin-1-yl)ethyl]-1,2,3,4,4a,6,7,8,9,9a-decahydrobenzo[7]annulen-5-ol |
| SMILES | CN1CCN(CC(c2cccc(Cl)c2)C2(O)CCCCC3CCCCC32)CC1 |
| InChI | InChI=1S/C24H37ClN2O/c1-26-13-15-27(16-14-26)18-23(20-9-6-10-21(25)17-20)24(28)12-5-4-8-19-7-2-3-11-22(19)24/h6,9-10,17,19,22-23,28H,2-5,7-8,11-16,18H2,1H3 |
| InChIKey | AGIMOMYGFHQKKO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.03 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |