C22H35Cl3N2O — CID 68854445
1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol;dihydrochloride (PubChem CID 68854445) has the molecular formula C22H35Cl3N2O and a molecular weight of 449.89 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol;dihydrochloride.
| Compound Name | 1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 68854445 |
| Molecular Formula | C22H35Cl3N2O |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(C(CN2CCNCC2)c2cccc(Cl)c2)CCCC2CCCCC21 |
| InChI | InChI=1S/C22H33ClN2O.2ClH/c23-19-8-3-6-18(15-19)21(16-25-13-11-24-12-14-25)22(26)10-4-7-17-5-1-2-9-20(17)22;;/h3,6,8,15,17,20-21,24,26H,1-2,4-5,7,9-14,16H2;2*1H |
| InChIKey | KBBBLIXJWWMMCO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |