C24H33Cl3N2O — CID 68855319
1-[1-[2-(3-chlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride (PubChem CID 68855319) has the molecular formula C24H33Cl3N2O and a molecular weight of 471.90 g/mol. Its IUPAC name is 1-[1-[2-(3-chlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride.
| Compound Name | 1-[1-[2-(3-chlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 68855319 |
| Molecular Formula | C24H33Cl3N2O |
| Molecular Weight | 471.90 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-[1-[2-(3-chlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(C(CN2CCNCC2)c2ccccc2-c2cccc(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C24H31ClN2O.2ClH/c25-20-8-6-7-19(17-20)21-9-2-3-10-22(21)23(18-27-15-13-26-14-16-27)24(28)11-4-1-5-12-24;;/h2-3,6-10,17,23,26,28H,1,4-5,11-16,18H2;2*1H |
| InChIKey | KPUWIDSNCDHXKE-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |