C20H28Cl2N2O — CID 68855773
1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclobutan-1-ol;dihydrochloride (PubChem CID 68855773) has the molecular formula C20H28Cl2N2O and a molecular weight of 383.36 g/mol. Its IUPAC name is 1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclobutan-1-ol;dihydrochloride.
| Compound Name | 1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclobutan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 68855773 |
| Molecular Formula | C20H28Cl2N2O |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclobutan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(C(CN2CCNCC2)c2cccc3ccccc23)CCC1 |
| InChI | InChI=1S/C20H26N2O.2ClH/c23-20(9-4-10-20)19(15-22-13-11-21-12-14-22)18-8-3-6-16-5-1-2-7-17(16)18;;/h1-3,5-8,19,21,23H,4,9-15H2;2*1H |
| InChIKey | WGAFSULIDVBLFK-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |