C21H30Cl2N2O — CID 68854522
1-[2-(4-aminopiperidin-1-yl)-1-naphthalen-1-ylethyl]cyclobutan-1-ol;dihydrochloride (PubChem CID 68854522) has the molecular formula C21H30Cl2N2O and a molecular weight of 397.39 g/mol. Its IUPAC name is 1-[2-(4-aminopiperidin-1-yl)-1-naphthalen-1-ylethyl]cyclobutan-1-ol;dihydrochloride.
| Compound Name | 1-[2-(4-aminopiperidin-1-yl)-1-naphthalen-1-ylethyl]cyclobutan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 68854522 |
| Molecular Formula | C21H30Cl2N2O |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[2-(4-aminopiperidin-1-yl)-1-naphthalen-1-ylethyl]cyclobutan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(CC(c2cccc3ccccc23)C2(O)CCC2)CC1 |
| InChI | InChI=1S/C21H28N2O.2ClH/c22-17-9-13-23(14-10-17)15-20(21(24)11-4-12-21)19-8-3-6-16-5-1-2-7-18(16)19;;/h1-3,5-8,17,20,24H,4,9-15,22H2;2*1H |
| InChIKey | VEALBBNLMSGRDL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |