C26H38N2O — CID 11153627
4-tert-butyl-1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclohexan-1-ol (PubChem CID 11153627) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is 4-tert-butyl-1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 11153627 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | 4-tert-butyl-1-(1-naphthalen-1-yl-2-piperazin-1-ylethyl)cyclohexan-1-ol |
| SMILES | CC(C)(C)C1CCC(O)(C(CN2CCNCC2)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C26H38N2O/c1-25(2,3)21-11-13-26(29,14-12-21)24(19-28-17-15-27-16-18-28)23-10-6-8-20-7-4-5-9-22(20)23/h4-10,21,24,27,29H,11-19H2,1-3H3 |
| InChIKey | VHNDPYFDLPRWNW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |