C27H40N2O — CID 11269823
4-tert-butyl-1-[2-(4-methylpiperazin-1-yl)-1-naphthalen-1-ylethyl]cyclohexan-1-ol (PubChem CID 11269823) has the molecular formula C27H40N2O and a molecular weight of 408.63 g/mol. Its IUPAC name is 4-tert-butyl-1-[2-(4-methylpiperazin-1-yl)-1-naphthalen-1-ylethyl]cyclohexan-1-ol.
| Compound Name | 4-tert-butyl-1-[2-(4-methylpiperazin-1-yl)-1-naphthalen-1-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11269823 |
| Molecular Formula | C27H40N2O |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 4-tert-butyl-1-[2-(4-methylpiperazin-1-yl)-1-naphthalen-1-ylethyl]cyclohexan-1-ol |
| SMILES | CN1CCN(CC(c2cccc3ccccc23)C2(O)CCC(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C27H40N2O/c1-26(2,3)22-12-14-27(30,15-13-22)25(20-29-18-16-28(4)17-19-29)24-11-7-9-21-8-5-6-10-23(21)24/h5-11,22,25,30H,12-20H2,1-4H3 |
| InChIKey | IUMMUJFGGVLQAX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |