C19H22O3 — CID 129386565
(2R)-2-(1-hydroxy-4-methylcyclohexyl)-2-naphthalen-1-ylacetic acid (PubChem CID 129386565) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (2R)-2-(1-hydroxy-4-methylcyclohexyl)-2-naphthalen-1-ylacetic acid.
| Compound Name | (2R)-2-(1-hydroxy-4-methylcyclohexyl)-2-naphthalen-1-ylacetic acid |
|---|---|
| PubChem CID | 129386565 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (2R)-2-(1-hydroxy-4-methylcyclohexyl)-2-naphthalen-1-ylacetic acid |
| SMILES | CC1CCC(O)([C@H](C(=O)O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C19H22O3/c1-13-9-11-19(22,12-10-13)17(18(20)21)16-8-4-6-14-5-2-3-7-15(14)16/h2-8,13,17,22H,9-12H2,1H3,(H,20,21)/t13?,17-,19?/m0/s1 |
| InChIKey | MXWSEAGTOJHTEF-KZGIRGLMSA-N |
| XLogP | 3.95 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |