C23H28N2O4 — CID 68865519
[(3R)-1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]pyrrolidin-3-yl]carbamic acid (PubChem CID 68865519) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(3R)-1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]pyrrolidin-3-yl]carbamic acid.
| Compound Name | [(3R)-1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]pyrrolidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 68865519 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(3R)-1-[2-(1-hydroxycyclohexyl)-2-naphthalen-1-ylacetyl]pyrrolidin-3-yl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1CCN(C(=O)C(c2cccc3ccccc23)C2(O)CCCCC2)C1 |
| InChI | InChI=1S/C23H28N2O4/c26-21(25-14-11-17(15-25)24-22(27)28)20(23(29)12-4-1-5-13-23)19-10-6-8-16-7-2-3-9-18(16)19/h2-3,6-10,17,20,24,29H,1,4-5,11-15H2,(H,27,28)/t17-,20?/m1/s1 |
| InChIKey | XCVBTNAXLDTRPG-DIAVIDTQSA-N |
| XLogP | 3.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |