C20H27BrN2O4 — CID 69018973
[1-[2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperidin-4-yl]carbamic acid (PubChem CID 69018973) has the molecular formula C20H27BrN2O4 and a molecular weight of 439.35 g/mol. Its IUPAC name is [1-[2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 69018973 |
| Molecular Formula | C20H27BrN2O4 |
| Molecular Weight | 439.35 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | [1-[2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)acetyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(C(=O)C(c2cccc(Br)c2)C2(O)CCCCC2)CC1 |
| InChI | InChI=1S/C20H27BrN2O4/c21-15-6-4-5-14(13-15)17(20(27)9-2-1-3-10-20)18(24)23-11-7-16(8-12-23)22-19(25)26/h4-6,13,16-17,22,27H,1-3,7-12H2,(H,25,26) |
| InChIKey | SOPRRWDWKCGEJX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |