C18H24BrNO3 — CID 68854082
2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)-1-morpholin-4-ylethanone (PubChem CID 68854082) has the molecular formula C18H24BrNO3 and a molecular weight of 382.30 g/mol. Its IUPAC name is 2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)-1-morpholin-4-ylethanone.
| Compound Name | 2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 68854082 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(3-bromophenyl)-2-(1-hydroxycyclohexyl)-1-morpholin-4-ylethanone |
| SMILES | O=C(C(c1cccc(Br)c1)C1(O)CCCCC1)N1CCOCC1 |
| InChI | InChI=1S/C18H24BrNO3/c19-15-6-4-5-14(13-15)16(18(22)7-2-1-3-8-18)17(21)20-9-11-23-12-10-20/h4-6,13,16,22H,1-3,7-12H2 |
| InChIKey | LMZWXBMHHRWZEI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |