C23H33ClN2O4 — CID 154120762
butyl N-[(3R)-1-[2-(3-chlorophenyl)-2-(1-hydroxycyclohexyl)acetyl]pyrrolidin-3-yl]carbamate (PubChem CID 154120762) has the molecular formula C23H33ClN2O4 and a molecular weight of 436.98 g/mol. Its IUPAC name is butyl N-[(3R)-1-[2-(3-chlorophenyl)-2-(1-hydroxycyclohexyl)acetyl]pyrrolidin-3-yl]carbamate.
| Compound Name | butyl N-[(3R)-1-[2-(3-chlorophenyl)-2-(1-hydroxycyclohexyl)acetyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 154120762 |
| Molecular Formula | C23H33ClN2O4 |
| Molecular Weight | 436.98 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | butyl N-[(3R)-1-[2-(3-chlorophenyl)-2-(1-hydroxycyclohexyl)acetyl]pyrrolidin-3-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H]1CCN(C(=O)C(c2cccc(Cl)c2)C2(O)CCCCC2)C1 |
| InChI | InChI=1S/C23H33ClN2O4/c1-2-3-14-30-22(28)25-19-10-13-26(16-19)21(27)20(17-8-7-9-18(24)15-17)23(29)11-5-4-6-12-23/h7-9,15,19-20,29H,2-6,10-14,16H2,1H3,(H,25,28)/t19-,20?/m1/s1 |
| InChIKey | LMGKWXCOZRALHZ-FIWHBWSRSA-N |
| XLogP | 4.25 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.98 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|