C24H36N2O — CID 143037071
1-[2-[[(2R)-2-(dimethylamino)propyl]-methylamino]-1-naphthalen-1-ylethyl]cyclohexan-1-ol (PubChem CID 143037071) has the molecular formula C24H36N2O and a molecular weight of 368.57 g/mol. Its IUPAC name is 1-[2-[[(2R)-2-(dimethylamino)propyl]-methylamino]-1-naphthalen-1-ylethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-[[(2R)-2-(dimethylamino)propyl]-methylamino]-1-naphthalen-1-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143037071 |
| Molecular Formula | C24H36N2O |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | 1-[2-[[(2R)-2-(dimethylamino)propyl]-methylamino]-1-naphthalen-1-ylethyl]cyclohexan-1-ol |
| SMILES | C[C@H](CN(C)CC(c1cccc2ccccc12)C1(O)CCCCC1)N(C)C |
| InChI | InChI=1S/C24H36N2O/c1-19(25(2)3)17-26(4)18-23(24(27)15-8-5-9-16-24)22-14-10-12-20-11-6-7-13-21(20)22/h6-7,10-14,19,23,27H,5,8-9,15-18H2,1-4H3/t19-,23?/m1/s1 |
| InChIKey | OATFPIMXSYIKLV-HWYAHNCWSA-N |
| XLogP | 4.50 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |