C24H30Cl2N2O — CID 11475998
1-[1-[2-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol (PubChem CID 11475998) has the molecular formula C24H30Cl2N2O and a molecular weight of 433.42 g/mol. Its IUPAC name is 1-[1-[2-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol.
| Compound Name | 1-[1-[2-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11475998 |
| Molecular Formula | C24H30Cl2N2O |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 1-[1-[2-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol |
| SMILES | OC1(C(CN2CCNCC2)c2ccccc2-c2ccc(Cl)c(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C24H30Cl2N2O/c25-22-9-8-18(16-23(22)26)19-6-2-3-7-20(19)21(17-28-14-12-27-13-15-28)24(29)10-4-1-5-11-24/h2-3,6-9,16,21,27,29H,1,4-5,10-15,17H2 |
| InChIKey | OVOXVCGLRYMTSR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |