C16H25ClN2OS — CID 11324941
1-[1-(5-chlorothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol (PubChem CID 11324941) has the molecular formula C16H25ClN2OS and a molecular weight of 328.91 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol.
| Compound Name | 1-[1-(5-chlorothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11324941 |
| Molecular Formula | C16H25ClN2OS |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1-[1-(5-chlorothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol |
| SMILES | OC1(C(CN2CCNCC2)c2ccc(Cl)s2)CCCCC1 |
| InChI | InChI=1S/C16H25ClN2OS/c17-15-5-4-14(21-15)13(12-19-10-8-18-9-11-19)16(20)6-2-1-3-7-16/h4-5,13,18,20H,1-3,6-12H2 |
| InChIKey | QVVYUPDVPHVIPQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |