C22H26Cl2N2O — CID 11361736
1-[1-[4-(3,5-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol (PubChem CID 11361736) has the molecular formula C22H26Cl2N2O and a molecular weight of 405.37 g/mol. Its IUPAC name is 1-[1-[4-(3,5-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol.
| Compound Name | 1-[1-[4-(3,5-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol |
|---|---|
| PubChem CID | 11361736 |
| Molecular Formula | C22H26Cl2N2O |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-[1-[4-(3,5-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol |
| SMILES | OC1(C(CN2CCNCC2)c2ccc(-c3cc(Cl)cc(Cl)c3)cc2)CCC1 |
| InChI | InChI=1S/C22H26Cl2N2O/c23-19-12-18(13-20(24)14-19)16-2-4-17(5-3-16)21(22(27)6-1-7-22)15-26-10-8-25-9-11-26/h2-5,12-14,21,25,27H,1,6-11,15H2 |
| InChIKey | NFYJPYOLXCTCLC-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |