C18H29Cl3N2O — CID 11383887
1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride (PubChem CID 11383887) has the molecular formula C18H29Cl3N2O and a molecular weight of 395.80 g/mol. Its IUPAC name is 1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride.
| Compound Name | 1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 11383887 |
| Molecular Formula | C18H29Cl3N2O |
| Molecular Weight | 395.80 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 1-[1-(3-chlorophenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(C(CN2CCNCC2)c2cccc(Cl)c2)CCCCC1 |
| InChI | InChI=1S/C18H27ClN2O.2ClH/c19-16-6-4-5-15(13-16)17(14-21-11-9-20-10-12-21)18(22)7-2-1-3-8-18;;/h4-6,13,17,20,22H,1-3,7-12,14H2;2*1H |
| InChIKey | NESUISGAACOCQG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.80 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |