C21H33F3N2O2 — CID 143036937
ethane;1-[(1S)-2-piperazin-1-yl-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol (PubChem CID 143036937) has the molecular formula C21H33F3N2O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is ethane;1-[(1S)-2-piperazin-1-yl-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol.
| Compound Name | ethane;1-[(1S)-2-piperazin-1-yl-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143036937 |
| Molecular Formula | C21H33F3N2O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | ethane;1-[(1S)-2-piperazin-1-yl-1-[3-(trifluoromethoxy)phenyl]ethyl]cyclohexan-1-ol |
| SMILES | CC.OC1([C@H](CN2CCNCC2)c2cccc(OC(F)(F)F)c2)CCCCC1 |
| InChI | InChI=1S/C19H27F3N2O2.C2H6/c20-19(21,22)26-16-6-4-5-15(13-16)17(14-24-11-9-23-10-12-24)18(25)7-2-1-3-8-18;1-2/h4-6,13,17,23,25H,1-3,7-12,14H2;1-2H3/t17-;/m1./s1 |
| InChIKey | RRTYWANBMXTIKQ-UNTBIKODSA-N |
| XLogP | 4.30 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |