C20H29F3N2O3 — CID 59701176
1-[1-[4-methoxy-3-(trifluoromethoxy)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol (PubChem CID 59701176) has the molecular formula C20H29F3N2O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is 1-[1-[4-methoxy-3-(trifluoromethoxy)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol.
| Compound Name | 1-[1-[4-methoxy-3-(trifluoromethoxy)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 59701176 |
| Molecular Formula | C20H29F3N2O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 1-[1-[4-methoxy-3-(trifluoromethoxy)phenyl]-2-piperazin-1-ylethyl]cyclohexan-1-ol |
| SMILES | COc1ccc(C(CN2CCNCC2)C2(O)CCCCC2)cc1OC(F)(F)F |
| InChI | InChI=1S/C20H29F3N2O3/c1-27-17-6-5-15(13-18(17)28-20(21,22)23)16(14-25-11-9-24-10-12-25)19(26)7-3-2-4-8-19/h5-6,13,16,24,26H,2-4,7-12,14H2,1H3 |
| InChIKey | XGVPDSFGZMQZOG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |