C19H27F3N2O3 — CID 59701186
4-[1-(1-hydroxycyclohexyl)-2-piperazin-1-ylethyl]-2-(trifluoromethoxy)phenol (PubChem CID 59701186) has the molecular formula C19H27F3N2O3 and a molecular weight of 388.43 g/mol. Its IUPAC name is 4-[1-(1-hydroxycyclohexyl)-2-piperazin-1-ylethyl]-2-(trifluoromethoxy)phenol.
| Compound Name | 4-[1-(1-hydroxycyclohexyl)-2-piperazin-1-ylethyl]-2-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 59701186 |
| Molecular Formula | C19H27F3N2O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | 4-[1-(1-hydroxycyclohexyl)-2-piperazin-1-ylethyl]-2-(trifluoromethoxy)phenol |
| SMILES | Oc1ccc(C(CN2CCNCC2)C2(O)CCCCC2)cc1OC(F)(F)F |
| InChI | InChI=1S/C19H27F3N2O3/c20-19(21,22)27-17-12-14(4-5-16(17)25)15(13-24-10-8-23-9-11-24)18(26)6-2-1-3-7-18/h4-5,12,15,23,25-26H,1-3,6-11,13H2 |
| InChIKey | XWKDFKSBYLBMNC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |