C16H26BrClN2OS — CID 141128619
1-[1-(4-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;hydrochloride (PubChem CID 141128619) has the molecular formula C16H26BrClN2OS and a molecular weight of 409.82 g/mol. Its IUPAC name is 1-[1-(4-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;hydrochloride.
| Compound Name | 1-[1-(4-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 141128619 |
| Molecular Formula | C16H26BrClN2OS |
| Molecular Weight | 409.82 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | 1-[1-(4-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;hydrochloride |
| SMILES | Cl.OC1(C(CN2CCNCC2)c2cc(Br)cs2)CCCCC1 |
| InChI | InChI=1S/C16H25BrN2OS.ClH/c17-13-10-15(21-12-13)14(11-19-8-6-18-7-9-19)16(20)4-2-1-3-5-16;/h10,12,14,18,20H,1-9,11H2;1H |
| InChIKey | TUJDHKKSLOWHRT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.82 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |