C16H25BrN2OS — CID 11211006
1-[1-(5-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol (PubChem CID 11211006) has the molecular formula C16H25BrN2OS and a molecular weight of 373.36 g/mol. Its IUPAC name is 1-[1-(5-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol.
| Compound Name | 1-[1-(5-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 11211006 |
| Molecular Formula | C16H25BrN2OS |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-[1-(5-bromothiophen-2-yl)-2-piperazin-1-ylethyl]cyclohexan-1-ol |
| SMILES | OC1(C(CN2CCNCC2)c2ccc(Br)s2)CCCCC1 |
| InChI | InChI=1S/C16H25BrN2OS/c17-15-5-4-14(21-15)13(12-19-10-8-18-9-11-19)16(20)6-2-1-3-7-16/h4-5,13,18,20H,1-3,6-12H2 |
| InChIKey | LFLGWUQIVASPOV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |