C22H33Cl2N3O — CID 68852175
1-methyl-4-(1-naphthalen-2-yl-2-piperazin-1-ylethyl)piperidin-4-ol;dihydrochloride (PubChem CID 68852175) has the molecular formula C22H33Cl2N3O and a molecular weight of 426.43 g/mol. Its IUPAC name is 1-methyl-4-(1-naphthalen-2-yl-2-piperazin-1-ylethyl)piperidin-4-ol;dihydrochloride.
| Compound Name | 1-methyl-4-(1-naphthalen-2-yl-2-piperazin-1-ylethyl)piperidin-4-ol;dihydrochloride |
|---|---|
| PubChem CID | 68852175 |
| Molecular Formula | C22H33Cl2N3O |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | 1-methyl-4-(1-naphthalen-2-yl-2-piperazin-1-ylethyl)piperidin-4-ol;dihydrochloride |
| SMILES | CN1CCC(O)(C(CN2CCNCC2)c2ccc3ccccc3c2)CC1.Cl.Cl |
| InChI | InChI=1S/C22H31N3O.2ClH/c1-24-12-8-22(26,9-13-24)21(17-25-14-10-23-11-15-25)20-7-6-18-4-2-3-5-19(18)16-20;;/h2-7,16,21,23,26H,8-15,17H2,1H3;2*1H |
| InChIKey | LRQDSBIJTKASMW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |