C25H36Cl2N2O2 — CID 16660021
1-[1-(4-phenylmethoxyphenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride (PubChem CID 16660021) has the molecular formula C25H36Cl2N2O2 and a molecular weight of 467.48 g/mol. Its IUPAC name is 1-[1-(4-phenylmethoxyphenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride.
| Compound Name | 1-[1-(4-phenylmethoxyphenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
|---|---|
| PubChem CID | 16660021 |
| Molecular Formula | C25H36Cl2N2O2 |
| Molecular Weight | 467.48 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 1-[1-(4-phenylmethoxyphenyl)-2-piperazin-1-ylethyl]cyclohexan-1-ol;dihydrochloride |
| SMILES | Cl.Cl.OC1(C(CN2CCNCC2)c2ccc(OCc3ccccc3)cc2)CCCCC1 |
| InChI | InChI=1S/C25H34N2O2.2ClH/c28-25(13-5-2-6-14-25)24(19-27-17-15-26-16-18-27)22-9-11-23(12-10-22)29-20-21-7-3-1-4-8-21;;/h1,3-4,7-12,24,26,28H,2,5-6,13-20H2;2*1H |
| InChIKey | YJSZZTBEOMBBEJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.48 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |