C13H18OS — CID 115033656
3-[1-(thian-3-yl)ethyl]phenol (PubChem CID 115033656) has the molecular formula C13H18OS and a molecular weight of 222.35 g/mol. Its IUPAC name is 3-[1-(thian-3-yl)ethyl]phenol.
| Compound Name | 3-[1-(thian-3-yl)ethyl]phenol |
|---|---|
| PubChem CID | 115033656 |
| Molecular Formula | C13H18OS |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-[1-(thian-3-yl)ethyl]phenol |
| SMILES | CC(c1cccc(O)c1)C1CCCSC1 |
| InChI | InChI=1S/C13H18OS/c1-10(12-5-3-7-15-9-12)11-4-2-6-13(14)8-11/h2,4,6,8,10,12,14H,3,5,7,9H2,1H3 |
| InChIKey | GEFMFRBVFQUREI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |