About (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine
(2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine (PubChem CID 142197561) has the molecular formula C20H29NO
and a molecular weight of 299.46 g/mol. Its IUPAC name is (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine |
| PubChem CID | 142197561 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\CC)CNCc1cc(OC(C)C)cc(C(=C)C)c1 |
| InChI | InChI=1S/C20H29NO/c1-7-9-17(8-2)13-21-14-18-10-19(15(3)4)12-20(11-18)22-16(5)6/h7,9-12,16,21H,1,3,8,13-14H2,2,4-6H3/b17-9+ |
| InChIKey | FJVLZFKBCCYKHK-RQZCQDPDSA-N |
| XLogP | 5.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine?
The IUPAC name of (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine (CID 142197561) is (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine.
What is the SMILES notation for (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine?
The canonical SMILES for (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine is C=C/C=C(\CC)CNCc1cc(OC(C)C)cc(C(=C)C)c1.
What is the InChIKey of (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine?
The InChIKey is FJVLZFKBCCYKHK-RQZCQDPDSA-N. The full InChI is InChI=1S/C20H29NO/c1-7-9-17(8-2)13-21-14-18-10-19(15(3)4)12-20(11-18)22-16(5)6/h7,9-12,16,21H,1,3,8,13-14H2,2,4-6H3/b17-9+.
What are the key properties of (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine?
(2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine has a molecular weight of 299.46 g/mol, XLogP of 5.12, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine is sourced from PubChem (CID 142197561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).