C20H29NO — CID 142197561
(2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine (PubChem CID 142197561) has the molecular formula C20H29NO and a molecular weight of 299.46 g/mol. Its IUPAC name is (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine.
| Compound Name | (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142197561 |
| Molecular Formula | C20H29NO |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.22 |
| IUPAC Name | (2E)-2-ethyl-N-[(3-propan-2-yloxy-5-prop-1-en-2-ylphenyl)methyl]penta-2,4-dien-1-amine |
| SMILES | C=C/C=C(\CC)CNCc1cc(OC(C)C)cc(C(=C)C)c1 |
| InChI | InChI=1S/C20H29NO/c1-7-9-17(8-2)13-21-14-18-10-19(15(3)4)12-20(11-18)22-16(5)6/h7,9-12,16,21H,1,3,8,13-14H2,2,4-6H3/b17-9+ |
| InChIKey | FJVLZFKBCCYKHK-RQZCQDPDSA-N |
| XLogP | 5.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|