C22H23N3 — CID 130467456
N-[3,5-bis(methylideneamino)phenyl]-1-[3,5-bis(prop-1-en-2-yl)phenyl]ethanimine (PubChem CID 130467456) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is N-[3,5-bis(methylideneamino)phenyl]-1-[3,5-bis(prop-1-en-2-yl)phenyl]ethanimine.
| Compound Name | N-[3,5-bis(methylideneamino)phenyl]-1-[3,5-bis(prop-1-en-2-yl)phenyl]ethanimine |
|---|---|
| PubChem CID | 130467456 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | N-[3,5-bis(methylideneamino)phenyl]-1-[3,5-bis(prop-1-en-2-yl)phenyl]ethanimine |
| SMILES | C=Nc1cc(N=C)cc(/N=C(\C)c2cc(C(=C)C)cc(C(=C)C)c2)c1 |
| InChI | InChI=1S/C22H23N3/c1-14(2)17-8-18(15(3)4)10-19(9-17)16(5)25-22-12-20(23-6)11-21(13-22)24-7/h8-13H,1,3,6-7H2,2,4-5H3/b25-16+ |
| InChIKey | MGKGGPNBTJGWDB-PCLIKHOPSA-N |
| XLogP | 6.56 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|