C29H28N3+ — CID 130467507
1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[10-methyl-6-(methylideneamino)acridin-10-ium-3-yl]ethanimine (PubChem CID 130467507) has the molecular formula C29H28N3+ and a molecular weight of 418.56 g/mol. Its IUPAC name is 1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[10-methyl-6-(methylideneamino)acridin-10-ium-3-yl]ethanimine.
| Compound Name | 1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[10-methyl-6-(methylideneamino)acridin-10-ium-3-yl]ethanimine |
|---|---|
| PubChem CID | 130467507 |
| Molecular Formula | C29H28N3+ |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[10-methyl-6-(methylideneamino)acridin-10-ium-3-yl]ethanimine |
| SMILES | C=Nc1ccc2cc3ccc(/N=C(\C)c4cc(C(=C)C)cc(C(=C)C)c4)cc3[n+](C)c2c1 |
| InChI | InChI=1S/C29H28N3/c1-18(2)23-13-24(19(3)4)15-25(14-23)20(5)31-27-11-9-22-12-21-8-10-26(30-6)16-28(21)32(7)29(22)17-27/h8-17H,1,3,6H2,2,4-5,7H3/q+1 |
| InChIKey | UWGKGPUPOVAIOL-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|