C22H26N2 — CID 161266532
1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[4-(methylideneamino)phenyl]ethanimine;methane (PubChem CID 161266532) has the molecular formula C22H26N2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[4-(methylideneamino)phenyl]ethanimine;methane.
| Compound Name | 1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[4-(methylideneamino)phenyl]ethanimine;methane |
|---|---|
| PubChem CID | 161266532 |
| Molecular Formula | C22H26N2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-[3,5-bis(prop-1-en-2-yl)phenyl]-N-[4-(methylideneamino)phenyl]ethanimine;methane |
| SMILES | C.C=Nc1ccc(/N=C(\C)c2cc(C(=C)C)cc(C(=C)C)c2)cc1 |
| InChI | InChI=1S/C21H22N2.CH4/c1-14(2)17-11-18(15(3)4)13-19(12-17)16(5)23-21-9-7-20(22-6)8-10-21;/h7-13H,1,3,6H2,2,4-5H3;1H4/b23-16+; |
| InChIKey | VDGJSUKZZMNQFP-BVXBIMGVSA-N |
| XLogP | 6.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|