C11H9N3O3 — CID 82390734
6-(4-methoxyphenyl)-1,2,4-triazine-3-carboxylic acid (PubChem CID 82390734) has the molecular formula C11H9N3O3 and a molecular weight of 231.21 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-1,2,4-triazine-3-carboxylic acid.
| Compound Name | 6-(4-methoxyphenyl)-1,2,4-triazine-3-carboxylic acid |
|---|---|
| PubChem CID | 82390734 |
| Molecular Formula | C11H9N3O3 |
| Molecular Weight | 231.21 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-(4-methoxyphenyl)-1,2,4-triazine-3-carboxylic acid |
| SMILES | COc1ccc(-c2cnc(C(=O)O)nn2)cc1 |
| InChI | InChI=1S/C11H9N3O3/c1-17-8-4-2-7(3-5-8)9-6-12-10(11(15)16)14-13-9/h2-6H,1H3,(H,15,16) |
| InChIKey | BJUNMFQTVFTXCS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |