C11H8BrN3O — CID 82378720
1-[6-(3-bromophenyl)-1,2,4-triazin-3-yl]ethanone (PubChem CID 82378720) has the molecular formula C11H8BrN3O and a molecular weight of 278.11 g/mol. Its IUPAC name is 1-[6-(3-bromophenyl)-1,2,4-triazin-3-yl]ethanone.
| Compound Name | 1-[6-(3-bromophenyl)-1,2,4-triazin-3-yl]ethanone |
|---|---|
| PubChem CID | 82378720 |
| Molecular Formula | C11H8BrN3O |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 1-[6-(3-bromophenyl)-1,2,4-triazin-3-yl]ethanone |
| SMILES | CC(=O)c1ncc(-c2cccc(Br)c2)nn1 |
| InChI | InChI=1S/C11H8BrN3O/c1-7(16)11-13-6-10(14-15-11)8-3-2-4-9(12)5-8/h2-6H,1H3 |
| InChIKey | OBMKFVGFUUYSCU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |