C15H14BrNO3 — CID 78937691
(1R)-1-[4-(1,3-benzodioxol-5-yloxy)-3-bromophenyl]ethanamine (PubChem CID 78937691) has the molecular formula C15H14BrNO3 and a molecular weight of 336.19 g/mol. Its IUPAC name is (1R)-1-[4-(1,3-benzodioxol-5-yloxy)-3-bromophenyl]ethanamine.
| Compound Name | (1R)-1-[4-(1,3-benzodioxol-5-yloxy)-3-bromophenyl]ethanamine |
|---|---|
| PubChem CID | 78937691 |
| Molecular Formula | C15H14BrNO3 |
| Molecular Weight | 336.19 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | (1R)-1-[4-(1,3-benzodioxol-5-yloxy)-3-bromophenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(Oc2ccc3c(c2)OCO3)c(Br)c1 |
| InChI | InChI=1S/C15H14BrNO3/c1-9(17)10-2-4-13(12(16)6-10)20-11-3-5-14-15(7-11)19-8-18-14/h2-7,9H,8,17H2,1H3/t9-/m1/s1 |
| InChIKey | ZEVNSGKLSJNQFP-SECBINFHSA-N |
| XLogP | 3.99 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |