C13H7Cl2FO2 — CID 89397150
2-(3,4-dichlorophenoxy)-3-fluorobenzaldehyde (PubChem CID 89397150) has the molecular formula C13H7Cl2FO2 and a molecular weight of 285.10 g/mol. Its IUPAC name is 2-(3,4-dichlorophenoxy)-3-fluorobenzaldehyde.
| Compound Name | 2-(3,4-dichlorophenoxy)-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 89397150 |
| Molecular Formula | C13H7Cl2FO2 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 2-(3,4-dichlorophenoxy)-3-fluorobenzaldehyde |
| SMILES | O=Cc1cccc(F)c1Oc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H7Cl2FO2/c14-10-5-4-9(6-11(10)15)18-13-8(7-17)2-1-3-12(13)16/h1-7H |
| InChIKey | QXZQHHFJZGRWEE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|