C17H15F2NO4 — CID 23610227
N-[1-(1,3-benzodioxol-5-yloxy)propan-2-yl]-2,6-difluorobenzamide (PubChem CID 23610227) has the molecular formula C17H15F2NO4 and a molecular weight of 335.31 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yloxy)propan-2-yl]-2,6-difluorobenzamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yloxy)propan-2-yl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 23610227 |
| Molecular Formula | C17H15F2NO4 |
| Molecular Weight | 335.31 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yloxy)propan-2-yl]-2,6-difluorobenzamide |
| SMILES | CC(COc1ccc2c(c1)OCO2)NC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C17H15F2NO4/c1-10(20-17(21)16-12(18)3-2-4-13(16)19)8-22-11-5-6-14-15(7-11)24-9-23-14/h2-7,10H,8-9H2,1H3,(H,20,21) |
| InChIKey | JDLWOHDCSOLTRV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |