C12H14FNO4 — CID 170829944
N-[3-(5-fluoro-2-formylphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170829944) has the molecular formula C12H14FNO4 and a molecular weight of 255.24 g/mol. Its IUPAC name is N-[3-(5-fluoro-2-formylphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(5-fluoro-2-formylphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170829944 |
| Molecular Formula | C12H14FNO4 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | N-[3-(5-fluoro-2-formylphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc(F)ccc1C=O |
| InChI | InChI=1S/C12H14FNO4/c1-7(16)14-5-11(17)12(18)10-4-9(13)3-2-8(10)6-15/h2-4,6,11-12,17-18H,5H2,1H3,(H,14,16) |
| InChIKey | DRABSHDEGKBHGZ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|