C10H13NO4S — CID 170829493
N-[3-(4-formylthiophen-3-yl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170829493) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is N-[3-(4-formylthiophen-3-yl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(4-formylthiophen-3-yl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170829493 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | N-[3-(4-formylthiophen-3-yl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cscc1C=O |
| InChI | InChI=1S/C10H13NO4S/c1-6(13)11-2-9(14)10(15)8-5-16-4-7(8)3-12/h3-5,9-10,14-15H,2H2,1H3,(H,11,13) |
| InChIKey | WHKLYXUWUZPJHK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|