C11H14BrNO4 — CID 170831363
N-[3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170831363) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is N-[3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170831363 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | N-[3-(2-bromo-5-hydroxyphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc(O)ccc1Br |
| InChI | InChI=1S/C11H14BrNO4/c1-6(14)13-5-10(16)11(17)8-4-7(15)2-3-9(8)12/h2-4,10-11,15-17H,5H2,1H3,(H,13,14) |
| InChIKey | RBGLDPDYFVQCPU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |