C14H19NO6 — CID 170831222
N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170831222) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170831222 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[3-(5-formyl-2,3-dimethoxyphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | COc1cc(C=O)cc(C(O)C(O)CNC(C)=O)c1OC |
| InChI | InChI=1S/C14H19NO6/c1-8(17)15-6-11(18)13(19)10-4-9(7-16)5-12(20-2)14(10)21-3/h4-5,7,11,13,18-19H,6H2,1-3H3,(H,15,17) |
| InChIKey | OHKVVRHFCRJSGL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|