C12H13F2NO4 — CID 170830411
N-[3-(3,5-difluoro-4-formylphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170830411) has the molecular formula C12H13F2NO4 and a molecular weight of 273.24 g/mol. Its IUPAC name is N-[3-(3,5-difluoro-4-formylphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(3,5-difluoro-4-formylphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170830411 |
| Molecular Formula | C12H13F2NO4 |
| Molecular Weight | 273.24 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-[3-(3,5-difluoro-4-formylphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cc(F)c(C=O)c(F)c1 |
| InChI | InChI=1S/C12H13F2NO4/c1-6(17)15-4-11(18)12(19)7-2-9(13)8(5-16)10(14)3-7/h2-3,5,11-12,18-19H,4H2,1H3,(H,15,17) |
| InChIKey | HKLSXNUNNSRRRL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|