C9H13N3O3 — CID 170829458
N-(2,3-dihydroxy-3-pyrimidin-5-ylpropyl)acetamide (PubChem CID 170829458) has the molecular formula C9H13N3O3 and a molecular weight of 211.22 g/mol. Its IUPAC name is N-(2,3-dihydroxy-3-pyrimidin-5-ylpropyl)acetamide.
| Compound Name | N-(2,3-dihydroxy-3-pyrimidin-5-ylpropyl)acetamide |
|---|---|
| PubChem CID | 170829458 |
| Molecular Formula | C9H13N3O3 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-(2,3-dihydroxy-3-pyrimidin-5-ylpropyl)acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cncnc1 |
| InChI | InChI=1S/C9H13N3O3/c1-6(13)12-4-8(14)9(15)7-2-10-5-11-3-7/h2-3,5,8-9,14-15H,4H2,1H3,(H,12,13) |
| InChIKey | OVWUGHLPZQFTPO-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |