C17H20N2O4 — CID 170831077
N-[2,3-dihydroxy-3-(5-phenylmethoxy-3-pyridinyl)propyl]acetamide (PubChem CID 170831077) has the molecular formula C17H20N2O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[2,3-dihydroxy-3-(5-phenylmethoxy-3-pyridinyl)propyl]acetamide.
| Compound Name | N-[2,3-dihydroxy-3-(5-phenylmethoxy-3-pyridinyl)propyl]acetamide |
|---|---|
| PubChem CID | 170831077 |
| Molecular Formula | C17H20N2O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-[2,3-dihydroxy-3-(5-phenylmethoxy-3-pyridinyl)propyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cncc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C17H20N2O4/c1-12(20)19-10-16(21)17(22)14-7-15(9-18-8-14)23-11-13-5-3-2-4-6-13/h2-9,16-17,21-22H,10-11H2,1H3,(H,19,20) |
| InChIKey | KVGLETNYCWSHEO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |