C12H16N2O5 — CID 170830510
methyl 5-(3-acetamido-1,2-dihydroxypropyl)pyridine-3-carboxylate (PubChem CID 170830510) has the molecular formula C12H16N2O5 and a molecular weight of 268.27 g/mol. Its IUPAC name is methyl 5-(3-acetamido-1,2-dihydroxypropyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(3-acetamido-1,2-dihydroxypropyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 170830510 |
| Molecular Formula | C12H16N2O5 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | methyl 5-(3-acetamido-1,2-dihydroxypropyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(C(O)C(O)CNC(C)=O)c1 |
| InChI | InChI=1S/C12H16N2O5/c1-7(15)14-6-10(16)11(17)8-3-9(5-13-4-8)12(18)19-2/h3-5,10-11,16-17H,6H2,1-2H3,(H,14,15) |
| InChIKey | PMOFKAQOUDJIAY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |