C12H15NO5 — CID 170831298
N-[3-(1,3-benzodioxol-4-yl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170831298) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-4-yl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(1,3-benzodioxol-4-yl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170831298 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | N-[3-(1,3-benzodioxol-4-yl)-2,3-dihydroxypropyl]acetamide |
| SMILES | CC(=O)NCC(O)C(O)c1cccc2c1OCO2 |
| InChI | InChI=1S/C12H15NO5/c1-7(14)13-5-9(15)11(16)8-3-2-4-10-12(8)18-6-17-10/h2-4,9,11,15-16H,5-6H2,1H3,(H,13,14) |
| InChIKey | BOFUKYUXFTVFRB-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |