C13H15NO3 — CID 170831357
N-[3-(2-ethynylphenyl)-2,3-dihydroxypropyl]acetamide (PubChem CID 170831357) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[3-(2-ethynylphenyl)-2,3-dihydroxypropyl]acetamide.
| Compound Name | N-[3-(2-ethynylphenyl)-2,3-dihydroxypropyl]acetamide |
|---|---|
| PubChem CID | 170831357 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-[3-(2-ethynylphenyl)-2,3-dihydroxypropyl]acetamide |
| SMILES | C#Cc1ccccc1C(O)C(O)CNC(C)=O |
| InChI | InChI=1S/C13H15NO3/c1-3-10-6-4-5-7-11(10)13(17)12(16)8-14-9(2)15/h1,4-7,12-13,16-17H,8H2,2H3,(H,14,15) |
| InChIKey | DSAYAINPOVNFTH-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|