C10H12O4S — CID 170819742
3-(1,2-dihydroxy-3-sulfanylpropyl)-4-hydroxybenzaldehyde (PubChem CID 170819742) has the molecular formula C10H12O4S and a molecular weight of 228.27 g/mol. Its IUPAC name is 3-(1,2-dihydroxy-3-sulfanylpropyl)-4-hydroxybenzaldehyde.
| Compound Name | 3-(1,2-dihydroxy-3-sulfanylpropyl)-4-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 170819742 |
| Molecular Formula | C10H12O4S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 3-(1,2-dihydroxy-3-sulfanylpropyl)-4-hydroxybenzaldehyde |
| SMILES | O=Cc1ccc(O)c(C(O)C(O)CS)c1 |
| InChI | InChI=1S/C10H12O4S/c11-4-6-1-2-8(12)7(3-6)10(14)9(13)5-15/h1-4,9-10,12-15H,5H2 |
| InChIKey | OKAKZXKYAYUCEI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|